C9H10F3NOS — CID 154554763
3,3,3-trifluoro-N-(4-sulfanylcyclohexa-1,5-dien-1-yl)propanamide (PubChem CID 154554763) has the molecular formula C9H10F3NOS and a molecular weight of 237.25 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-(4-sulfanylcyclohexa-1,5-dien-1-yl)propanamide.
| Compound Name | 3,3,3-trifluoro-N-(4-sulfanylcyclohexa-1,5-dien-1-yl)propanamide |
|---|---|
| PubChem CID | 154554763 |
| Molecular Formula | C9H10F3NOS |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 3,3,3-trifluoro-N-(4-sulfanylcyclohexa-1,5-dien-1-yl)propanamide |
| SMILES | O=C(CC(F)(F)F)NC1=CCC(S)C=C1 |
| InChI | InChI=1S/C9H10F3NOS/c10-9(11,12)5-8(14)13-6-1-3-7(15)4-2-6/h1-3,7,15H,4-5H2,(H,13,14) |
| InChIKey | XFGRMMVLAKJANY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|