C21H24IN3O3 — CID 154554774
N-[(1R)-2,3-dihydro-1H-inden-1-yl]-2-[1-(2-iodoacetyl)piperidin-4-yl]-N-methyl-1,3-oxazole-4-carboxamide (PubChem CID 154554774) has the molecular formula C21H24IN3O3 and a molecular weight of 493.35 g/mol. Its IUPAC name is N-[(1R)-2,3-dihydro-1H-inden-1-yl]-2-[1-(2-iodoacetyl)piperidin-4-yl]-N-methyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-[(1R)-2,3-dihydro-1H-inden-1-yl]-2-[1-(2-iodoacetyl)piperidin-4-yl]-N-methyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 154554774 |
| Molecular Formula | C21H24IN3O3 |
| Molecular Weight | 493.35 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | N-[(1R)-2,3-dihydro-1H-inden-1-yl]-2-[1-(2-iodoacetyl)piperidin-4-yl]-N-methyl-1,3-oxazole-4-carboxamide |
| SMILES | CN(C(=O)c1coc(C2CCN(C(=O)CI)CC2)n1)[C@@H]1CCc2ccccc21 |
| InChI | InChI=1S/C21H24IN3O3/c1-24(18-7-6-14-4-2-3-5-16(14)18)21(27)17-13-28-20(23-17)15-8-10-25(11-9-15)19(26)12-22/h2-5,13,15,18H,6-12H2,1H3/t18-/m1/s1 |
| InChIKey | ANMFBDWKRIJILM-GOSISDBHSA-N |
| XLogP | 3.58 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|