C7H7N3O2 — CID 154554959
3-hydroxy-5,6-dihydro-1,2,3-benzotriazin-4-one (PubChem CID 154554959) has the molecular formula C7H7N3O2 and a molecular weight of 165.15 g/mol. Its IUPAC name is 3-hydroxy-5,6-dihydro-1,2,3-benzotriazin-4-one.
| Compound Name | 3-hydroxy-5,6-dihydro-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 154554959 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | 3-hydroxy-5,6-dihydro-1,2,3-benzotriazin-4-one |
| SMILES | O=c1c2c(nnn1O)C=CCC2 |
| InChI | InChI=1S/C7H7N3O2/c11-7-5-3-1-2-4-6(5)8-9-10(7)12/h2,4,12H,1,3H2 |
| InChIKey | MHIOXFFNYKCPJY-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|