C21H23N5O3S — CID 154555042
N-[[3-[3-(3-aminoprop-2-enylideneamino)propoxy]phenyl]methyl]-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-2-carboxamide (PubChem CID 154555042) has the molecular formula C21H23N5O3S and a molecular weight of 425.51 g/mol. Its IUPAC name is N-[[3-[3-(3-aminoprop-2-enylideneamino)propoxy]phenyl]methyl]-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-2-carboxamide.
| Compound Name | N-[[3-[3-(3-aminoprop-2-enylideneamino)propoxy]phenyl]methyl]-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 154555042 |
| Molecular Formula | C21H23N5O3S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | N-[[3-[3-(3-aminoprop-2-enylideneamino)propoxy]phenyl]methyl]-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-2-carboxamide |
| SMILES | Cc1csc2nc(C(=O)NCc3cccc(OCCC/N=C/C=CN)c3)[nH]c(=O)c12 |
| InChI | InChI=1S/C21H23N5O3S/c1-14-13-30-21-17(14)19(27)25-18(26-21)20(28)24-12-15-5-2-6-16(11-15)29-10-4-9-23-8-3-7-22/h2-3,5-8,11,13H,4,9-10,12,22H2,1H3,(H,24,28)(H,25,26,27)/b7-3?,23-8+ |
| InChIKey | CNFFJRNJMWRZTR-QKTKTLELSA-N |
| XLogP | 2.54 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|