About 4,5-dihydro-1,3-benzodioxol-5-ylmethanol
4,5-dihydro-1,3-benzodioxol-5-ylmethanol (PubChem CID 154555493) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is 4,5-dihydro-1,3-benzodioxol-5-ylmethanol.
Molecular Properties
| Compound Name | 4,5-dihydro-1,3-benzodioxol-5-ylmethanol |
| PubChem CID | 154555493 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 4,5-dihydro-1,3-benzodioxol-5-ylmethanol |
| SMILES | OCC1C=CC2=C(C1)OCO2 |
| InChI | InChI=1S/C8H10O3/c9-4-6-1-2-7-8(3-6)11-5-10-7/h1-2,6,9H,3-5H2 |
| InChIKey | HHOUSAKTOXYENQ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dihydro-1,3-benzodioxol-5-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydro-1,3-benzodioxol-5-ylmethanol?
The IUPAC name of 4,5-dihydro-1,3-benzodioxol-5-ylmethanol (CID 154555493) is 4,5-dihydro-1,3-benzodioxol-5-ylmethanol.
What is the SMILES notation for 4,5-dihydro-1,3-benzodioxol-5-ylmethanol?
The canonical SMILES for 4,5-dihydro-1,3-benzodioxol-5-ylmethanol is OCC1C=CC2=C(C1)OCO2.
What is the InChIKey of 4,5-dihydro-1,3-benzodioxol-5-ylmethanol?
The InChIKey is HHOUSAKTOXYENQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c9-4-6-1-2-7-8(3-6)11-5-10-7/h1-2,6,9H,3-5H2.
What are the key properties of 4,5-dihydro-1,3-benzodioxol-5-ylmethanol?
4,5-dihydro-1,3-benzodioxol-5-ylmethanol has a molecular weight of 154.16 g/mol, XLogP of 0.77, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydro-1,3-benzodioxol-5-ylmethanol is sourced from PubChem (CID 154555493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).