About 1-chloro-3-propan-2-ylbenzene-6-ide;trifluoromethane;uranium(2+)
1-chloro-3-propan-2-ylbenzene-6-ide;trifluoromethane;uranium(2+) (PubChem CID 154556358) has the molecular formula C10H10ClF3U
and a molecular weight of 460.67 g/mol. Its IUPAC name is 1-chloro-3-propan-2-ylbenzene-6-ide;trifluoromethane;uranium(2+).
Molecular Properties
| Compound Name | 1-chloro-3-propan-2-ylbenzene-6-ide;trifluoromethane;uranium(2+) |
| PubChem CID | 154556358 |
| Molecular Formula | C10H10ClF3U |
| Molecular Weight | 460.67 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 1-chloro-3-propan-2-ylbenzene-6-ide;trifluoromethane;uranium(2+) |
| SMILES | CC(C)c1cc[c-]c(Cl)c1.F[C-](F)F.[U+2] |
| InChI | InChI=1S/C9H10Cl.CF3.U/c1-7(2)8-4-3-5-9(10)6-8;2-1(3)4;/h3-4,6-7H,1-2H3;;/q2*-1;+2 |
| InChIKey | BPBROWBYHBVMIA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.67 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3-propan-2-ylbenzene-6-ide;trifluoromethane;uranium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-propan-2-ylbenzene-6-ide;trifluoromethane;uranium(2+)?
The IUPAC name of 1-chloro-3-propan-2-ylbenzene-6-ide;trifluoromethane;uranium(2+) (CID 154556358) is 1-chloro-3-propan-2-ylbenzene-6-ide;trifluoromethane;uranium(2+).
What is the SMILES notation for 1-chloro-3-propan-2-ylbenzene-6-ide;trifluoromethane;uranium(2+)?
The canonical SMILES for 1-chloro-3-propan-2-ylbenzene-6-ide;trifluoromethane;uranium(2+) is CC(C)c1cc[c-]c(Cl)c1.F[C-](F)F.[U+2].
What is the InChIKey of 1-chloro-3-propan-2-ylbenzene-6-ide;trifluoromethane;uranium(2+)?
The InChIKey is BPBROWBYHBVMIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10Cl.CF3.U/c1-7(2)8-4-3-5-9(10)6-8;2-1(3)4;/h3-4,6-7H,1-2H3;;/q2*-1;+2.
What are the key properties of 1-chloro-3-propan-2-ylbenzene-6-ide;trifluoromethane;uranium(2+)?
1-chloro-3-propan-2-ylbenzene-6-ide;trifluoromethane;uranium(2+) has a molecular weight of 460.67 g/mol, XLogP of 4.61, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-propan-2-ylbenzene-6-ide;trifluoromethane;uranium(2+) is sourced from PubChem (CID 154556358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).