C8H8INO2 — CID 154556737
7-(iodomethyl)-2,3-dihydro-[1,4]dioxino[2,3-c]pyridine (PubChem CID 154556737) has the molecular formula C8H8INO2 and a molecular weight of 277.06 g/mol. Its IUPAC name is 7-(iodomethyl)-2,3-dihydro-[1,4]dioxino[2,3-c]pyridine.
| Compound Name | 7-(iodomethyl)-2,3-dihydro-[1,4]dioxino[2,3-c]pyridine |
|---|---|
| PubChem CID | 154556737 |
| Molecular Formula | C8H8INO2 |
| Molecular Weight | 277.06 g/mol |
| Exact Mass | 276.96 |
| IUPAC Name | 7-(iodomethyl)-2,3-dihydro-[1,4]dioxino[2,3-c]pyridine |
| SMILES | ICc1cc2c(cn1)OCCO2 |
| InChI | InChI=1S/C8H8INO2/c9-4-6-3-7-8(5-10-6)12-2-1-11-7/h3,5H,1-2,4H2 |
| InChIKey | QDPDDXLUZKXQAC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.06 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|