C12H12S4Se2 — CID 15455710
2-(4,5,6,7-tetrahydro-1,3-benzodithiol-2-ylidene)-5,6-dihydro-[1,3]diselenolo[4,5-b][1,4]dithiine (PubChem CID 15455710) has the molecular formula C12H12S4Se2 and a molecular weight of 442.42 g/mol. Its IUPAC name is 2-(4,5,6,7-tetrahydro-1,3-benzodithiol-2-ylidene)-5,6-dihydro-[1,3]diselenolo[4,5-b][1,4]dithiine.
| Compound Name | 2-(4,5,6,7-tetrahydro-1,3-benzodithiol-2-ylidene)-5,6-dihydro-[1,3]diselenolo[4,5-b][1,4]dithiine |
|---|---|
| PubChem CID | 15455710 |
| Molecular Formula | C12H12S4Se2 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 443.82 |
| IUPAC Name | 2-(4,5,6,7-tetrahydro-1,3-benzodithiol-2-ylidene)-5,6-dihydro-[1,3]diselenolo[4,5-b][1,4]dithiine |
| SMILES | C1CCC2=C(C1)SC(=C1[Se]C3=C(SCCS3)[Se]1)S2 |
| InChI | InChI=1S/C12H12S4Se2/c1-2-4-8-7(3-1)15-9(16-8)12-17-10-11(18-12)14-6-5-13-10/h1-6H2 |
| InChIKey | OWNGBIVZHKCXBP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|