C9H9AlN2O2 — CID 154561873
methyl 6-alumanylpyrazolo[1,5-a]pyridine-3-carboxylate (PubChem CID 154561873) has the molecular formula C9H9AlN2O2 and a molecular weight of 204.16 g/mol. Its IUPAC name is methyl 6-alumanylpyrazolo[1,5-a]pyridine-3-carboxylate.
| Compound Name | methyl 6-alumanylpyrazolo[1,5-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 154561873 |
| Molecular Formula | C9H9AlN2O2 |
| Molecular Weight | 204.16 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | methyl 6-alumanylpyrazolo[1,5-a]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cnn2cc([AlH2])ccc12 |
| InChI | InChI=1S/C9H7N2O2.Al.2H/c1-13-9(12)7-6-10-11-5-3-2-4-8(7)11;;;/h2,4-6H,1H3;;; |
| InChIKey | YPCJYBKKYNBQPH-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.16 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |