About tert-butyl-dimethyl-[3-[(1E,3E)-4-nitrobuta-1,3-dienyl]indol-1-yl]silane
tert-butyl-dimethyl-[3-[(1E,3E)-4-nitrobuta-1,3-dienyl]indol-1-yl]silane (PubChem CID 15456195) has the molecular formula C18H24N2O2Si
and a molecular weight of 328.49 g/mol. Its IUPAC name is tert-butyl-dimethyl-[3-[(1E,3E)-4-nitrobuta-1,3-dienyl]indol-1-yl]silane.
Molecular Properties
| Compound Name | tert-butyl-dimethyl-[3-[(1E,3E)-4-nitrobuta-1,3-dienyl]indol-1-yl]silane |
| PubChem CID | 15456195 |
| Molecular Formula | C18H24N2O2Si |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | tert-butyl-dimethyl-[3-[(1E,3E)-4-nitrobuta-1,3-dienyl]indol-1-yl]silane |
| SMILES | CC(C)(C)[Si](C)(C)n1cc(/C=C/C=C/[N+](=O)[O-])c2ccccc21 |
| InChI | InChI=1S/C18H24N2O2Si/c1-18(2,3)23(4,5)19-14-15(10-8-9-13-20(21)22)16-11-6-7-12-17(16)19/h6-14H,1-5H3/b10-8+,13-9+ |
| InChIKey | CBDYYNDZBPESCY-IAQVKYGWSA-N |
| XLogP | 5.30 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-dimethyl-[3-[(1E,3E)-4-nitrobuta-1,3-dienyl]indol-1-yl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-dimethyl-[3-[(1E,3E)-4-nitrobuta-1,3-dienyl]indol-1-yl]silane?
The IUPAC name of tert-butyl-dimethyl-[3-[(1E,3E)-4-nitrobuta-1,3-dienyl]indol-1-yl]silane (CID 15456195) is tert-butyl-dimethyl-[3-[(1E,3E)-4-nitrobuta-1,3-dienyl]indol-1-yl]silane.
What is the SMILES notation for tert-butyl-dimethyl-[3-[(1E,3E)-4-nitrobuta-1,3-dienyl]indol-1-yl]silane?
The canonical SMILES for tert-butyl-dimethyl-[3-[(1E,3E)-4-nitrobuta-1,3-dienyl]indol-1-yl]silane is CC(C)(C)[Si](C)(C)n1cc(/C=C/C=C/[N+](=O)[O-])c2ccccc21.
What is the InChIKey of tert-butyl-dimethyl-[3-[(1E,3E)-4-nitrobuta-1,3-dienyl]indol-1-yl]silane?
The InChIKey is CBDYYNDZBPESCY-IAQVKYGWSA-N. The full InChI is InChI=1S/C18H24N2O2Si/c1-18(2,3)23(4,5)19-14-15(10-8-9-13-20(21)22)16-11-6-7-12-17(16)19/h6-14H,1-5H3/b10-8+,13-9+.
What are the key properties of tert-butyl-dimethyl-[3-[(1E,3E)-4-nitrobuta-1,3-dienyl]indol-1-yl]silane?
tert-butyl-dimethyl-[3-[(1E,3E)-4-nitrobuta-1,3-dienyl]indol-1-yl]silane has a molecular weight of 328.49 g/mol, XLogP of 5.30, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-dimethyl-[3-[(1E,3E)-4-nitrobuta-1,3-dienyl]indol-1-yl]silane is sourced from PubChem (CID 15456195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).