C7H3F11N2OS — CID 15456269
2-amino-5-fluoro-5-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)-1,3-thiazol-4-ol (PubChem CID 15456269) has the molecular formula C7H3F11N2OS and a molecular weight of 372.16 g/mol. Its IUPAC name is 2-amino-5-fluoro-5-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)-1,3-thiazol-4-ol.
| Compound Name | 2-amino-5-fluoro-5-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 15456269 |
| Molecular Formula | C7H3F11N2OS |
| Molecular Weight | 372.16 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | 2-amino-5-fluoro-5-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)-1,3-thiazol-4-ol |
| SMILES | NC1=NC(O)(C(F)(F)F)C(F)(C(F)(F)C(F)(F)C(F)(F)F)S1 |
| InChI | InChI=1S/C7H3F11N2OS/c8-2(9,3(10,11)6(13,14)15)4(12)5(21,7(16,17)18)20-1(19)22-4/h21H,(H2,19,20) |
| InChIKey | WRHNPQSSLMUSCX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.16 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|