C22H27N3O4S — CID 154563638
ethyl (3aS,4S,5S,7aR)-5-methyl-2-(2-methyl-5-pyrazol-1-ylphenyl)sulfonyl-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate (PubChem CID 154563638) has the molecular formula C22H27N3O4S and a molecular weight of 429.54 g/mol. Its IUPAC name is ethyl (3aS,4S,5S,7aR)-5-methyl-2-(2-methyl-5-pyrazol-1-ylphenyl)sulfonyl-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate.
| Compound Name | ethyl (3aS,4S,5S,7aR)-5-methyl-2-(2-methyl-5-pyrazol-1-ylphenyl)sulfonyl-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate |
|---|---|
| PubChem CID | 154563638 |
| Molecular Formula | C22H27N3O4S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | ethyl (3aS,4S,5S,7aR)-5-methyl-2-(2-methyl-5-pyrazol-1-ylphenyl)sulfonyl-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2CN(S(=O)(=O)c3cc(-n4cccn4)ccc3C)C[C@@H]2C=C[C@@H]1C |
| InChI | InChI=1S/C22H27N3O4S/c1-4-29-22(26)21-16(3)6-8-17-13-24(14-19(17)21)30(27,28)20-12-18(9-7-15(20)2)25-11-5-10-23-25/h5-12,16-17,19,21H,4,13-14H2,1-3H3/t16-,17-,19-,21-/m0/s1 |
| InChIKey | YTICCODHIZMYJW-VKRLORBYSA-N |
| XLogP | 2.80 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|