About prop-2-enyl 2-methylsulfanyl-4,5-dihydroimidazole-1-carboxylate
prop-2-enyl 2-methylsulfanyl-4,5-dihydroimidazole-1-carboxylate (PubChem CID 15456373) has the molecular formula C8H12N2O2S
and a molecular weight of 200.26 g/mol. Its IUPAC name is prop-2-enyl 2-methylsulfanyl-4,5-dihydroimidazole-1-carboxylate.
Molecular Properties
| Compound Name | prop-2-enyl 2-methylsulfanyl-4,5-dihydroimidazole-1-carboxylate |
| PubChem CID | 15456373 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | prop-2-enyl 2-methylsulfanyl-4,5-dihydroimidazole-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCN=C1SC |
| InChI | InChI=1S/C8H12N2O2S/c1-3-6-12-8(11)10-5-4-9-7(10)13-2/h3H,1,4-6H2,2H3 |
| InChIKey | JXLRHMBVSZJFDI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 2-methylsulfanyl-4,5-dihydroimidazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 2-methylsulfanyl-4,5-dihydroimidazole-1-carboxylate?
The IUPAC name of prop-2-enyl 2-methylsulfanyl-4,5-dihydroimidazole-1-carboxylate (CID 15456373) is prop-2-enyl 2-methylsulfanyl-4,5-dihydroimidazole-1-carboxylate.
What is the SMILES notation for prop-2-enyl 2-methylsulfanyl-4,5-dihydroimidazole-1-carboxylate?
The canonical SMILES for prop-2-enyl 2-methylsulfanyl-4,5-dihydroimidazole-1-carboxylate is C=CCOC(=O)N1CCN=C1SC.
What is the InChIKey of prop-2-enyl 2-methylsulfanyl-4,5-dihydroimidazole-1-carboxylate?
The InChIKey is JXLRHMBVSZJFDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S/c1-3-6-12-8(11)10-5-4-9-7(10)13-2/h3H,1,4-6H2,2H3.
What are the key properties of prop-2-enyl 2-methylsulfanyl-4,5-dihydroimidazole-1-carboxylate?
prop-2-enyl 2-methylsulfanyl-4,5-dihydroimidazole-1-carboxylate has a molecular weight of 200.26 g/mol, XLogP of 1.34, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 2-methylsulfanyl-4,5-dihydroimidazole-1-carboxylate is sourced from PubChem (CID 15456373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).