C18H24N4OS — CID 154563814
1-[(1R,2S,9R)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-2-imidazo[2,1-b][1,3]thiazol-6-ylethanone (PubChem CID 154563814) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is 1-[(1R,2S,9R)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-2-imidazo[2,1-b][1,3]thiazol-6-ylethanone.
| Compound Name | 1-[(1R,2S,9R)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-2-imidazo[2,1-b][1,3]thiazol-6-ylethanone |
|---|---|
| PubChem CID | 154563814 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 1-[(1R,2S,9R)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-2-imidazo[2,1-b][1,3]thiazol-6-ylethanone |
| SMILES | O=C(Cc1cn2ccsc2n1)N1C[C@@H]2C[C@H](C1)[C@@H]1CCCCN1C2 |
| InChI | InChI=1S/C18H24N4OS/c23-17(8-15-12-21-5-6-24-18(21)19-15)22-10-13-7-14(11-22)16-3-1-2-4-20(16)9-13/h5-6,12-14,16H,1-4,7-11H2/t13-,14-,16+/m1/s1 |
| InChIKey | NFYQHBGCFZEBTA-FMKPAKJESA-N |
| XLogP | 2.27 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |