C20H24N2S2 — CID 15456489
1-methylsulfanyl-3-(1-methylsulfanyl-5,6,7,8-tetrahydroisoquinolin-3-yl)-5,6,7,8-tetrahydroisoquinoline (PubChem CID 15456489) has the molecular formula C20H24N2S2 and a molecular weight of 356.56 g/mol. Its IUPAC name is 1-methylsulfanyl-3-(1-methylsulfanyl-5,6,7,8-tetrahydroisoquinolin-3-yl)-5,6,7,8-tetrahydroisoquinoline.
| Compound Name | 1-methylsulfanyl-3-(1-methylsulfanyl-5,6,7,8-tetrahydroisoquinolin-3-yl)-5,6,7,8-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 15456489 |
| Molecular Formula | C20H24N2S2 |
| Molecular Weight | 356.56 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 1-methylsulfanyl-3-(1-methylsulfanyl-5,6,7,8-tetrahydroisoquinolin-3-yl)-5,6,7,8-tetrahydroisoquinoline |
| SMILES | CSc1nc(-c2cc3c(c(SC)n2)CCCC3)cc2c1CCCC2 |
| InChI | InChI=1S/C20H24N2S2/c1-23-19-15-9-5-3-7-13(15)11-17(21-19)18-12-14-8-4-6-10-16(14)20(22-18)24-2/h11-12H,3-10H2,1-2H3 |
| InChIKey | OWLYPRNIQDFWOZ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |