C18H19ClN2O4S — CID 154565297
[(3S,3aS,6aR)-3-amino-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-[5-(2-chlorophenyl)-2-methylfuran-3-yl]methanone (PubChem CID 154565297) has the molecular formula C18H19ClN2O4S and a molecular weight of 394.88 g/mol. Its IUPAC name is [(3S,3aS,6aR)-3-amino-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-[5-(2-chlorophenyl)-2-methylfuran-3-yl]methanone.
| Compound Name | [(3S,3aS,6aR)-3-amino-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-[5-(2-chlorophenyl)-2-methylfuran-3-yl]methanone |
|---|---|
| PubChem CID | 154565297 |
| Molecular Formula | C18H19ClN2O4S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | [(3S,3aS,6aR)-3-amino-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-[5-(2-chlorophenyl)-2-methylfuran-3-yl]methanone |
| SMILES | Cc1oc(-c2ccccc2Cl)cc1C(=O)N1C[C@H]2[C@H](N)CS(=O)(=O)[C@H]2C1 |
| InChI | InChI=1S/C18H19ClN2O4S/c1-10-12(6-16(25-10)11-4-2-3-5-14(11)19)18(22)21-7-13-15(20)9-26(23,24)17(13)8-21/h2-6,13,15,17H,7-9,20H2,1H3/t13-,15+,17-/m0/s1 |
| InChIKey | TVEWWERRUKFELY-LXZKKBNFSA-N |
| XLogP | 2.10 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |