C19H30N6O3S — CID 154565713
(4aR,6S,8aS)-2-acetyl-N-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxamide (PubChem CID 154565713) has the molecular formula C19H30N6O3S and a molecular weight of 422.56 g/mol. Its IUPAC name is (4aR,6S,8aS)-2-acetyl-N-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxamide.
| Compound Name | (4aR,6S,8aS)-2-acetyl-N-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxamide |
|---|---|
| PubChem CID | 154565713 |
| Molecular Formula | C19H30N6O3S |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | (4aR,6S,8aS)-2-acetyl-N-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxamide |
| SMILES | CC(=O)N1CC[C@@H]2C[C@@H](N3CCOCC3)CC[C@@]2(C(=O)NCc2nnc(N)s2)C1 |
| InChI | InChI=1S/C19H30N6O3S/c1-13(26)25-5-3-14-10-15(24-6-8-28-9-7-24)2-4-19(14,12-25)17(27)21-11-16-22-23-18(20)29-16/h14-15H,2-12H2,1H3,(H2,20,23)(H,21,27)/t14-,15+,19-/m1/s1 |
| InChIKey | LVMOYJNUWFEJQA-ZRGWGRIASA-N |
| XLogP | 0.48 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |