About 1-[2-[(3S,5R)-3-amino-5-hydroxypiperidin-1-yl]-2-oxoethyl]-2-methylquinolin-4-one
1-[2-[(3S,5R)-3-amino-5-hydroxypiperidin-1-yl]-2-oxoethyl]-2-methylquinolin-4-one (PubChem CID 154566626) has the molecular formula C17H21N3O3
and a molecular weight of 315.37 g/mol. Its IUPAC name is 1-[2-[(3S,5R)-3-amino-5-hydroxypiperidin-1-yl]-2-oxoethyl]-2-methylquinolin-4-one.
Molecular Properties
| Compound Name | 1-[2-[(3S,5R)-3-amino-5-hydroxypiperidin-1-yl]-2-oxoethyl]-2-methylquinolin-4-one |
| PubChem CID | 154566626 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 1-[2-[(3S,5R)-3-amino-5-hydroxypiperidin-1-yl]-2-oxoethyl]-2-methylquinolin-4-one |
| SMILES | Cc1cc(=O)c2ccccc2n1CC(=O)N1C[C@@H](N)C[C@@H](O)C1 |
| InChI | InChI=1S/C17H21N3O3/c1-11-6-16(22)14-4-2-3-5-15(14)20(11)10-17(23)19-8-12(18)7-13(21)9-19/h2-6,12-13,21H,7-10,18H2,1H3/t12-,13+/m0/s1 |
| InChIKey | BYWXMOVQELQRMF-QWHCGFSZSA-N |
| XLogP | 0.23 |
| TPSA | 88.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-[(3S,5R)-3-amino-5-hydroxypiperidin-1-yl]-2-oxoethyl]-2-methylquinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(3S,5R)-3-amino-5-hydroxypiperidin-1-yl]-2-oxoethyl]-2-methylquinolin-4-one?
The IUPAC name of 1-[2-[(3S,5R)-3-amino-5-hydroxypiperidin-1-yl]-2-oxoethyl]-2-methylquinolin-4-one (CID 154566626) is 1-[2-[(3S,5R)-3-amino-5-hydroxypiperidin-1-yl]-2-oxoethyl]-2-methylquinolin-4-one.
What is the SMILES notation for 1-[2-[(3S,5R)-3-amino-5-hydroxypiperidin-1-yl]-2-oxoethyl]-2-methylquinolin-4-one?
The canonical SMILES for 1-[2-[(3S,5R)-3-amino-5-hydroxypiperidin-1-yl]-2-oxoethyl]-2-methylquinolin-4-one is Cc1cc(=O)c2ccccc2n1CC(=O)N1C[C@@H](N)C[C@@H](O)C1.
What is the InChIKey of 1-[2-[(3S,5R)-3-amino-5-hydroxypiperidin-1-yl]-2-oxoethyl]-2-methylquinolin-4-one?
The InChIKey is BYWXMOVQELQRMF-QWHCGFSZSA-N. The full InChI is InChI=1S/C17H21N3O3/c1-11-6-16(22)14-4-2-3-5-15(14)20(11)10-17(23)19-8-12(18)7-13(21)9-19/h2-6,12-13,21H,7-10,18H2,1H3/t12-,13+/m0/s1.
What are the key properties of 1-[2-[(3S,5R)-3-amino-5-hydroxypiperidin-1-yl]-2-oxoethyl]-2-methylquinolin-4-one?
1-[2-[(3S,5R)-3-amino-5-hydroxypiperidin-1-yl]-2-oxoethyl]-2-methylquinolin-4-one has a molecular weight of 315.37 g/mol, XLogP of 0.23, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(3S,5R)-3-amino-5-hydroxypiperidin-1-yl]-2-oxoethyl]-2-methylquinolin-4-one is sourced from PubChem (CID 154566626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).