C24H28N2O2 — CID 154568140
[(1R,2R,4S)-2-benzyl-2-(hydroxymethyl)-7-azabicyclo[2.2.1]heptan-7-yl]-(5,6,7,8-tetrahydroquinolin-3-yl)methanone (PubChem CID 154568140) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is [(1R,2R,4S)-2-benzyl-2-(hydroxymethyl)-7-azabicyclo[2.2.1]heptan-7-yl]-(5,6,7,8-tetrahydroquinolin-3-yl)methanone.
| Compound Name | [(1R,2R,4S)-2-benzyl-2-(hydroxymethyl)-7-azabicyclo[2.2.1]heptan-7-yl]-(5,6,7,8-tetrahydroquinolin-3-yl)methanone |
|---|---|
| PubChem CID | 154568140 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | [(1R,2R,4S)-2-benzyl-2-(hydroxymethyl)-7-azabicyclo[2.2.1]heptan-7-yl]-(5,6,7,8-tetrahydroquinolin-3-yl)methanone |
| SMILES | O=C(c1cnc2c(c1)CCCC2)N1[C@H]2CC[C@@H]1[C@@](CO)(Cc1ccccc1)C2 |
| InChI | InChI=1S/C24H28N2O2/c27-16-24(13-17-6-2-1-3-7-17)14-20-10-11-22(24)26(20)23(28)19-12-18-8-4-5-9-21(18)25-15-19/h1-3,6-7,12,15,20,22,27H,4-5,8-11,13-14,16H2/t20-,22+,24-/m0/s1 |
| InChIKey | GZEFVGTWHCFQED-FJIJXJHWSA-N |
| XLogP | 3.56 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |