C21H23N5O2 — CID 154569768
(2-methyl-3-phenyl-4,5,7,8-tetrahydropyrazolo[3,4-d]azepin-6-yl)-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)methanone (PubChem CID 154569768) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is (2-methyl-3-phenyl-4,5,7,8-tetrahydropyrazolo[3,4-d]azepin-6-yl)-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)methanone.
| Compound Name | (2-methyl-3-phenyl-4,5,7,8-tetrahydropyrazolo[3,4-d]azepin-6-yl)-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 154569768 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | (2-methyl-3-phenyl-4,5,7,8-tetrahydropyrazolo[3,4-d]azepin-6-yl)-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)methanone |
| SMILES | Cn1nc2c(c1-c1ccccc1)CCN(C(=O)c1n[nH]c3c1COCC3)CC2 |
| InChI | InChI=1S/C21H23N5O2/c1-25-20(14-5-3-2-4-6-14)15-7-10-26(11-8-18(15)24-25)21(27)19-16-13-28-12-9-17(16)22-23-19/h2-6H,7-13H2,1H3,(H,22,23) |
| InChIKey | YVQPGSQWCZVZKX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |