C20H30N4O — CID 154569986
[(1R,2S,9R)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)methanone (PubChem CID 154569986) has the molecular formula C20H30N4O and a molecular weight of 342.49 g/mol. Its IUPAC name is [(1R,2S,9R)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)methanone.
| Compound Name | [(1R,2S,9R)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)methanone |
|---|---|
| PubChem CID | 154569986 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | [(1R,2S,9R)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)methanone |
| SMILES | Cn1nc2c(c1C(=O)N1C[C@@H]3C[C@H](C1)[C@@H]1CCCCN1C3)CCCC2 |
| InChI | InChI=1S/C20H30N4O/c1-22-19(16-6-2-3-7-17(16)21-22)20(25)24-12-14-10-15(13-24)18-8-4-5-9-23(18)11-14/h14-15,18H,2-13H2,1H3/t14-,15-,18+/m1/s1 |
| InChIKey | MWUWSQARXFRFGQ-RKVPGOIHSA-N |
| XLogP | 2.25 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |