C19H26N2O3 — CID 154570449
(1R,2R,4S)-7-(2,5-dimethylfuran-3-carbonyl)-2-(3-methylbut-2-enyl)-7-azabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 154570449) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is (1R,2R,4S)-7-(2,5-dimethylfuran-3-carbonyl)-2-(3-methylbut-2-enyl)-7-azabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,2R,4S)-7-(2,5-dimethylfuran-3-carbonyl)-2-(3-methylbut-2-enyl)-7-azabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 154570449 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (1R,2R,4S)-7-(2,5-dimethylfuran-3-carbonyl)-2-(3-methylbut-2-enyl)-7-azabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CC(C)=CC[C@@]1(C(N)=O)C[C@@H]2CC[C@H]1N2C(=O)c1cc(C)oc1C |
| InChI | InChI=1S/C19H26N2O3/c1-11(2)7-8-19(18(20)23)10-14-5-6-16(19)21(14)17(22)15-9-12(3)24-13(15)4/h7,9,14,16H,5-6,8,10H2,1-4H3,(H2,20,23)/t14-,16+,19+/m0/s1 |
| InChIKey | MHWGKSVXPSDNSE-ZSZQSSIHSA-N |
| XLogP | 3.10 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|