C19H24ClN3O6S — CID 154570543
16-chloro-8-(1,1-dioxothiolane-3-carbonyl)-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione (PubChem CID 154570543) has the molecular formula C19H24ClN3O6S and a molecular weight of 457.94 g/mol. Its IUPAC name is 16-chloro-8-(1,1-dioxothiolane-3-carbonyl)-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione.
| Compound Name | 16-chloro-8-(1,1-dioxothiolane-3-carbonyl)-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione |
|---|---|
| PubChem CID | 154570543 |
| Molecular Formula | C19H24ClN3O6S |
| Molecular Weight | 457.94 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 16-chloro-8-(1,1-dioxothiolane-3-carbonyl)-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione |
| SMILES | O=C1CN(C(=O)C2CCS(=O)(=O)C2)CCCNC(=O)c2cc(Cl)ccc2OCCN1 |
| InChI | InChI=1S/C19H24ClN3O6S/c20-14-2-3-16-15(10-14)18(25)22-5-1-7-23(11-17(24)21-6-8-29-16)19(26)13-4-9-30(27,28)12-13/h2-3,10,13H,1,4-9,11-12H2,(H,21,24)(H,22,25) |
| InChIKey | PYQOJHOCLVKFFV-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.94 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |