About 4-fluoro-1-methyl-2,3-dihydropyrrole
4-fluoro-1-methyl-2,3-dihydropyrrole (PubChem CID 154572373) has the molecular formula C5H8FN
and a molecular weight of 101.12 g/mol. Its IUPAC name is 4-fluoro-1-methyl-2,3-dihydropyrrole.
Molecular Properties
| Compound Name | 4-fluoro-1-methyl-2,3-dihydropyrrole |
| PubChem CID | 154572373 |
| Molecular Formula | C5H8FN |
| Molecular Weight | 101.12 g/mol |
| Exact Mass | 101.06 |
| IUPAC Name | 4-fluoro-1-methyl-2,3-dihydropyrrole |
| SMILES | CN1C=C(F)CC1 |
| InChI | InChI=1S/C5H8FN/c1-7-3-2-5(6)4-7/h4H,2-3H2,1H3 |
| InChIKey | LKEJPLLOLVEODZ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.12 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoro-1-methyl-2,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1-methyl-2,3-dihydropyrrole?
The IUPAC name of 4-fluoro-1-methyl-2,3-dihydropyrrole (CID 154572373) is 4-fluoro-1-methyl-2,3-dihydropyrrole.
What is the SMILES notation for 4-fluoro-1-methyl-2,3-dihydropyrrole?
The canonical SMILES for 4-fluoro-1-methyl-2,3-dihydropyrrole is CN1C=C(F)CC1.
What is the InChIKey of 4-fluoro-1-methyl-2,3-dihydropyrrole?
The InChIKey is LKEJPLLOLVEODZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8FN/c1-7-3-2-5(6)4-7/h4H,2-3H2,1H3.
What are the key properties of 4-fluoro-1-methyl-2,3-dihydropyrrole?
4-fluoro-1-methyl-2,3-dihydropyrrole has a molecular weight of 101.12 g/mol, XLogP of 1.13, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1-methyl-2,3-dihydropyrrole is sourced from PubChem (CID 154572373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).