C12H14O4S2 — CID 154572766
propyl (2S,3R)-1,1-dioxo-2-sulfanyl-2,3-dihydro-1-benzothiophene-3-carboxylate (PubChem CID 154572766) has the molecular formula C12H14O4S2 and a molecular weight of 286.37 g/mol. Its IUPAC name is propyl (2S,3R)-1,1-dioxo-2-sulfanyl-2,3-dihydro-1-benzothiophene-3-carboxylate.
| Compound Name | propyl (2S,3R)-1,1-dioxo-2-sulfanyl-2,3-dihydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 154572766 |
| Molecular Formula | C12H14O4S2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | propyl (2S,3R)-1,1-dioxo-2-sulfanyl-2,3-dihydro-1-benzothiophene-3-carboxylate |
| SMILES | CCCOC(=O)[C@H]1c2ccccc2S(=O)(=O)[C@@H]1S |
| InChI | InChI=1S/C12H14O4S2/c1-2-7-16-11(13)10-8-5-3-4-6-9(8)18(14,15)12(10)17/h3-6,10,12,17H,2,7H2,1H3/t10-,12+/m1/s1 |
| InChIKey | MOPWOAJFBVRUBD-PWSUYJOCSA-N |
| XLogP | 1.77 |
| TPSA | 60.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|