About 4-(2-phenylethyl)-2,3-dihydro-1-benzofuran-6,7-diol
4-(2-phenylethyl)-2,3-dihydro-1-benzofuran-6,7-diol (PubChem CID 154572929) has the molecular formula C16H16O3
and a molecular weight of 256.30 g/mol. Its IUPAC name is 4-(2-phenylethyl)-2,3-dihydro-1-benzofuran-6,7-diol.
Molecular Properties
| Compound Name | 4-(2-phenylethyl)-2,3-dihydro-1-benzofuran-6,7-diol |
| PubChem CID | 154572929 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 4-(2-phenylethyl)-2,3-dihydro-1-benzofuran-6,7-diol |
| SMILES | Oc1cc(CCc2ccccc2)c2c(c1O)OCC2 |
| InChI | InChI=1S/C16H16O3/c17-14-10-12(7-6-11-4-2-1-3-5-11)13-8-9-19-16(13)15(14)18/h1-5,10,17-18H,6-9H2 |
| InChIKey | DPIABMWDLHEDSP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-phenylethyl)-2,3-dihydro-1-benzofuran-6,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-phenylethyl)-2,3-dihydro-1-benzofuran-6,7-diol?
The IUPAC name of 4-(2-phenylethyl)-2,3-dihydro-1-benzofuran-6,7-diol (CID 154572929) is 4-(2-phenylethyl)-2,3-dihydro-1-benzofuran-6,7-diol.
What is the SMILES notation for 4-(2-phenylethyl)-2,3-dihydro-1-benzofuran-6,7-diol?
The canonical SMILES for 4-(2-phenylethyl)-2,3-dihydro-1-benzofuran-6,7-diol is Oc1cc(CCc2ccccc2)c2c(c1O)OCC2.
What is the InChIKey of 4-(2-phenylethyl)-2,3-dihydro-1-benzofuran-6,7-diol?
The InChIKey is DPIABMWDLHEDSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O3/c17-14-10-12(7-6-11-4-2-1-3-5-11)13-8-9-19-16(13)15(14)18/h1-5,10,17-18H,6-9H2.
What are the key properties of 4-(2-phenylethyl)-2,3-dihydro-1-benzofuran-6,7-diol?
4-(2-phenylethyl)-2,3-dihydro-1-benzofuran-6,7-diol has a molecular weight of 256.30 g/mol, XLogP of 2.82, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-phenylethyl)-2,3-dihydro-1-benzofuran-6,7-diol is sourced from PubChem (CID 154572929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).