C19H16N6O3 — CID 154572978
3-ethoxy-5-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]-1H-1,2,4-triazole (PubChem CID 154572978) has the molecular formula C19H16N6O3 and a molecular weight of 376.38 g/mol. Its IUPAC name is 3-ethoxy-5-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]-1H-1,2,4-triazole.
| Compound Name | 3-ethoxy-5-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 154572978 |
| Molecular Formula | C19H16N6O3 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 3-ethoxy-5-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]-1H-1,2,4-triazole |
| SMILES | CCOc1n[nH]c(-c2cn(-c3ccccc3)nc2-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C19H16N6O3/c1-2-28-19-20-18(21-22-19)16-12-24(14-6-4-3-5-7-14)23-17(16)13-8-10-15(11-9-13)25(26)27/h3-12H,2H2,1H3,(H,20,21,22) |
| InChIKey | RKMQLNFGESCMLT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 111.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|