C48H91N2O11P — CID 154573330
[3-[[3-(2,6-diaminohexanoyloxy)-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(Z)-octadec-11-enoyl]oxypropyl] (Z)-octadec-11-enoate (PubChem CID 154573330) has the molecular formula C48H91N2O11P and a molecular weight of 903.23 g/mol. Its IUPAC name is [3-[[3-(2,6-diaminohexanoyloxy)-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(Z)-octadec-11-enoyl]oxypropyl] (Z)-octadec-11-enoate.
| Compound Name | [3-[[3-(2,6-diaminohexanoyloxy)-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(Z)-octadec-11-enoyl]oxypropyl] (Z)-octadec-11-enoate |
|---|---|
| PubChem CID | 154573330 |
| Molecular Formula | C48H91N2O11P |
| Molecular Weight | 903.23 g/mol |
| Exact Mass | 902.64 |
| IUPAC Name | [3-[[3-(2,6-diaminohexanoyloxy)-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(Z)-octadec-11-enoyl]oxypropyl] (Z)-octadec-11-enoate |
| SMILES | CCCCCC/C=C\CCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COC(=O)C(N)CCCCN)OC(=O)CCCCCCCCC/C=C\CCCCCC |
| InChI | InChI=1S/C48H91N2O11P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-36-46(52)57-41-44(42-60-62(55,56)59-40-43(51)39-58-48(54)45(50)35-33-34-38-49)61-47(53)37-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h13-16,43-45,51H,3-12,17-42,49-50H2,1-2H3,(H,55,56)/b15-13-,16-14- |
| InChIKey | KXVLNWHKIRGBHL-VMNXYWKNSA-N |
| XLogP | 11.01 |
| TPSA | 206.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.23 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|