C12H21N5O6 — CID 154573635
5-[[(2S)-2-aminopropylidene]amino]-6-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]-1H-pyrimidine-2,4-dione (PubChem CID 154573635) has the molecular formula C12H21N5O6 and a molecular weight of 331.33 g/mol. Its IUPAC name is 5-[[(2S)-2-aminopropylidene]amino]-6-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[[(2S)-2-aminopropylidene]amino]-6-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 154573635 |
| Molecular Formula | C12H21N5O6 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 5-[[(2S)-2-aminopropylidene]amino]-6-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]-1H-pyrimidine-2,4-dione |
| SMILES | C[C@H](N)/C=N/c1c(NC[C@H](O)[C@H](O)[C@H](O)CO)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H21N5O6/c1-5(13)2-14-8-10(16-12(23)17-11(8)22)15-3-6(19)9(21)7(20)4-18/h2,5-7,9,18-21H,3-4,13H2,1H3,(H3,15,16,17,22,23)/b14-2+/t5-,6-,7+,9-/m0/s1 |
| InChIKey | PBYDOKKYTVHTFW-LSFUNWLISA-N |
| XLogP | -3.40 |
| TPSA | 197.05 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|