C40H56N2O2 — CID 154573678
2,2,6,6-tetramethyl-1-[1-[4-[4-[4-[1-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethyl]phenyl]phenyl]phenyl]ethoxy]piperidine (PubChem CID 154573678) has the molecular formula C40H56N2O2 and a molecular weight of 596.90 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-[1-[4-[4-[4-[1-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethyl]phenyl]phenyl]phenyl]ethoxy]piperidine.
| Compound Name | 2,2,6,6-tetramethyl-1-[1-[4-[4-[4-[1-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethyl]phenyl]phenyl]phenyl]ethoxy]piperidine |
|---|---|
| PubChem CID | 154573678 |
| Molecular Formula | C40H56N2O2 |
| Molecular Weight | 596.90 g/mol |
| Exact Mass | 596.43 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-[1-[4-[4-[4-[1-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethyl]phenyl]phenyl]phenyl]ethoxy]piperidine |
| SMILES | CC(ON1C(C)(C)CCCC1(C)C)c1ccc(-c2ccc(-c3ccc(C(C)ON4C(C)(C)CCCC4(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C40H56N2O2/c1-29(43-41-37(3,4)25-11-26-38(41,5)6)31-13-17-33(18-14-31)35-21-23-36(24-22-35)34-19-15-32(16-20-34)30(2)44-42-39(7,8)27-12-28-40(42,9)10/h13-24,29-30H,11-12,25-28H2,1-10H3 |
| InChIKey | QHMSDIYSZBIKPC-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.90 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |