C12H14N2O3 — CID 154573691
(6aS)-4,6-dihydroxy-5,6,6a,7,8,9-hexahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one (PubChem CID 154573691) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is (6aS)-4,6-dihydroxy-5,6,6a,7,8,9-hexahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one.
| Compound Name | (6aS)-4,6-dihydroxy-5,6,6a,7,8,9-hexahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
|---|---|
| PubChem CID | 154573691 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | (6aS)-4,6-dihydroxy-5,6,6a,7,8,9-hexahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| SMILES | O=C1c2cccc(O)c2NC(O)[C@@H]2CCCN12 |
| InChI | InChI=1S/C12H14N2O3/c15-9-5-1-3-7-10(9)13-11(16)8-4-2-6-14(8)12(7)17/h1,3,5,8,11,13,15-16H,2,4,6H2/t8-,11?/m0/s1 |
| InChIKey | QEILHZZUMSPTRX-YMNIQAILSA-N |
| XLogP | 0.74 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|