C17H22O9 — CID 154573933
1-O-benzyl 3-O-[(2R,3S,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl] propanedioate (PubChem CID 154573933) has the molecular formula C17H22O9 and a molecular weight of 370.35 g/mol. Its IUPAC name is 1-O-benzyl 3-O-[(2R,3S,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl] propanedioate.
| Compound Name | 1-O-benzyl 3-O-[(2R,3S,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl] propanedioate |
|---|---|
| PubChem CID | 154573933 |
| Molecular Formula | C17H22O9 |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 1-O-benzyl 3-O-[(2R,3S,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl] propanedioate |
| SMILES | CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](OC(=O)CC(=O)OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C17H22O9/c1-23-17-15(22)16(14(21)11(8-18)25-17)26-13(20)7-12(19)24-9-10-5-3-2-4-6-10/h2-6,11,14-18,21-22H,7-9H2,1H3/t11-,14+,15-,16+,17-/m1/s1 |
| InChIKey | NMJLHFMLSWSVNI-GNXUOLQESA-N |
| XLogP | -0.88 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|