C17H20N3O2- — CID 154573940
5-methyl-1-[1-(4-methylidenecyclohexa-1,5-dien-1-yl)piperidin-4-yl]pyrimidine-2,4-dione (PubChem CID 154573940) has the molecular formula C17H20N3O2- and a molecular weight of 298.37 g/mol. Its IUPAC name is 5-methyl-1-[1-(4-methylidenecyclohexa-1,5-dien-1-yl)piperidin-4-yl]pyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-[1-(4-methylidenecyclohexa-1,5-dien-1-yl)piperidin-4-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 154573940 |
| Molecular Formula | C17H20N3O2- |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 5-methyl-1-[1-(4-methylidenecyclohexa-1,5-dien-1-yl)piperidin-4-yl]pyrimidine-2,4-dione |
| SMILES | C=C1C=CC(N2CCC(n3cc(C)c(=O)[nH]c3=O)CC2)=C[CH-]1 |
| InChI | InChI=1S/C17H20N3O2/c1-12-3-5-14(6-4-12)19-9-7-15(8-10-19)20-11-13(2)16(21)18-17(20)22/h3-6,11,15H,1,7-10H2,2H3,(H,18,21,22)/q-1 |
| InChIKey | XWDMVUKIFHEEMX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|