About oxazepino[6,7-a]acridine
oxazepino[6,7-a]acridine (PubChem CID 154574061) has the molecular formula C16H10N2O
and a molecular weight of 246.27 g/mol. Its IUPAC name is oxazepino[6,7-a]acridine.
Molecular Properties
| Compound Name | oxazepino[6,7-a]acridine |
| PubChem CID | 154574061 |
| Molecular Formula | C16H10N2O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | oxazepino[6,7-a]acridine |
| SMILES | C1=Cc2c(ccc3nc4ccccc4cc23)ON=C1 |
| InChI | InChI=1S/C16H10N2O/c1-2-6-14-11(4-1)10-13-12-5-3-9-17-19-16(12)8-7-15(13)18-14/h1-10H |
| InChIKey | WDRXBDBJVJIENO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze oxazepino[6,7-a]acridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxazepino[6,7-a]acridine?
The IUPAC name of oxazepino[6,7-a]acridine (CID 154574061) is oxazepino[6,7-a]acridine.
What is the SMILES notation for oxazepino[6,7-a]acridine?
The canonical SMILES for oxazepino[6,7-a]acridine is C1=Cc2c(ccc3nc4ccccc4cc23)ON=C1.
What is the InChIKey of oxazepino[6,7-a]acridine?
The InChIKey is WDRXBDBJVJIENO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N2O/c1-2-6-14-11(4-1)10-13-12-5-3-9-17-19-16(12)8-7-15(13)18-14/h1-10H.
What are the key properties of oxazepino[6,7-a]acridine?
oxazepino[6,7-a]acridine has a molecular weight of 246.27 g/mol, XLogP of 3.78, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxazepino[6,7-a]acridine is sourced from PubChem (CID 154574061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).