C17H12ClF3N4OS2 — CID 154574288
1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[4-chloro-3-(trifluoromethyl)phenyl]urea (PubChem CID 154574288) has the molecular formula C17H12ClF3N4OS2 and a molecular weight of 444.89 g/mol. Its IUPAC name is 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[4-chloro-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 154574288 |
| Molecular Formula | C17H12ClF3N4OS2 |
| Molecular Weight | 444.89 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)Nc1nnc(SCc2ccccc2)s1 |
| InChI | InChI=1S/C17H12ClF3N4OS2/c18-13-7-6-11(8-12(13)17(19,20)21)22-14(26)23-15-24-25-16(28-15)27-9-10-4-2-1-3-5-10/h1-8H,9H2,(H2,22,23,24,26) |
| InChIKey | OPWAGNTYKXOQNO-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.89 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|