C17H11ClF4N4OS2 — CID 154574315
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]urea (PubChem CID 154574315) has the molecular formula C17H11ClF4N4OS2 and a molecular weight of 462.88 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 154574315 |
| Molecular Formula | C17H11ClF4N4OS2 |
| Molecular Weight | 462.88 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]urea |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)Nc1nnc(SCc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C17H11ClF4N4OS2/c18-13-6-5-11(7-12(13)17(20,21)22)23-14(27)24-15-25-26-16(29-15)28-8-9-1-3-10(19)4-2-9/h1-7H,8H2,(H2,23,24,25,27) |
| InChIKey | RDZGTMMEBFGIOY-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.88 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|