C17H11Cl2F3N4OS2 — CID 154574316
1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea (PubChem CID 154574316) has the molecular formula C17H11Cl2F3N4OS2 and a molecular weight of 479.34 g/mol. Its IUPAC name is 1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 154574316 |
| Molecular Formula | C17H11Cl2F3N4OS2 |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 477.97 |
| IUPAC Name | 1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)Nc1nnc(SCc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C17H11Cl2F3N4OS2/c18-10-3-1-9(2-4-10)8-28-16-26-25-15(29-16)24-14(27)23-11-5-6-13(19)12(7-11)17(20,21)22/h1-7H,8H2,(H2,23,24,25,27) |
| InChIKey | UWZMXVKPDJFDFU-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|