C18H14ClF3N4OS2 — CID 154574317
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[5-[(3-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]urea (PubChem CID 154574317) has the molecular formula C18H14ClF3N4OS2 and a molecular weight of 458.92 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[5-[(3-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[5-[(3-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 154574317 |
| Molecular Formula | C18H14ClF3N4OS2 |
| Molecular Weight | 458.92 g/mol |
| Exact Mass | 458.02 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[5-[(3-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]urea |
| SMILES | Cc1cccc(CSc2nnc(NC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)s2)c1 |
| InChI | InChI=1S/C18H14ClF3N4OS2/c1-10-3-2-4-11(7-10)9-28-17-26-25-16(29-17)24-15(27)23-12-5-6-14(19)13(8-12)18(20,21)22/h2-8H,9H2,1H3,(H2,23,24,25,27) |
| InChIKey | WRIYMDUTCBHXMO-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.92 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|