C4H6O — CID 154574408
1,1,2-trideuterio-2-(1,2,2-trideuterioethenoxy)ethene (PubChem CID 154574408) has the molecular formula C4H6O and a molecular weight of 76.13 g/mol. Its IUPAC name is 1,1,2-trideuterio-2-(1,2,2-trideuterioethenoxy)ethene.
| Compound Name | 1,1,2-trideuterio-2-(1,2,2-trideuterioethenoxy)ethene |
|---|---|
| PubChem CID | 154574408 |
| Molecular Formula | C4H6O |
| Molecular Weight | 76.13 g/mol |
| Exact Mass | 76.08 |
| IUPAC Name | 1,1,2-trideuterio-2-(1,2,2-trideuterioethenoxy)ethene |
| SMILES | [2H]C([2H])=C([2H])OC([2H])=C([2H])[2H] |
| InChI | InChI=1S/C4H6O/c1-3-5-4-2/h3-4H,1-2H2/i1D2,2D2,3D,4D |
| InChIKey | QYKIQEUNHZKYBP-UFSLNRCZSA-N |
| XLogP | 1.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 76.13 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|