C21H24N2O4 — CID 154575193
(3S,4S,6R)-3-ethenyl-6-[(R)-hydroxy-(6-methoxyquinolin-4-yl)methyl]-1-azabicyclo[2.2.2]octane-3-carboxylic acid (PubChem CID 154575193) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is (3S,4S,6R)-3-ethenyl-6-[(R)-hydroxy-(6-methoxyquinolin-4-yl)methyl]-1-azabicyclo[2.2.2]octane-3-carboxylic acid.
| Compound Name | (3S,4S,6R)-3-ethenyl-6-[(R)-hydroxy-(6-methoxyquinolin-4-yl)methyl]-1-azabicyclo[2.2.2]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 154575193 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (3S,4S,6R)-3-ethenyl-6-[(R)-hydroxy-(6-methoxyquinolin-4-yl)methyl]-1-azabicyclo[2.2.2]octane-3-carboxylic acid |
| SMILES | C=C[C@@]1(C(=O)O)CN2CC[C@H]1C[C@@H]2[C@H](O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C21H24N2O4/c1-3-21(20(25)26)12-23-9-7-13(21)10-18(23)19(24)15-6-8-22-17-5-4-14(27-2)11-16(15)17/h3-6,8,11,13,18-19,24H,1,7,9-10,12H2,2H3,(H,25,26)/t13-,18+,19+,21+/m0/s1 |
| InChIKey | ODEKVGFMXNUYKH-PTMNIEHFSA-N |
| XLogP | 2.63 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|