C20H33BN2O3 — CID 154575228
2-[(1-tert-butylpyrrolidin-3-yl)methoxy]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 154575228) has the molecular formula C20H33BN2O3 and a molecular weight of 360.31 g/mol. Its IUPAC name is 2-[(1-tert-butylpyrrolidin-3-yl)methoxy]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 2-[(1-tert-butylpyrrolidin-3-yl)methoxy]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 154575228 |
| Molecular Formula | C20H33BN2O3 |
| Molecular Weight | 360.31 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | 2-[(1-tert-butylpyrrolidin-3-yl)methoxy]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CC(C)(C)N1CCC(COc2ncccc2B2OC(C)(C)C(C)(C)O2)C1 |
| InChI | InChI=1S/C20H33BN2O3/c1-18(2,3)23-12-10-15(13-23)14-24-17-16(9-8-11-22-17)21-25-19(4,5)20(6,7)26-21/h8-9,11,15H,10,12-14H2,1-7H3 |
| InChIKey | JUIGQAXLIJZTNA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|