2-(oxolan-2-yl)ethanesulfonyl fluoride

C6H11FO3S — CID 154575248

IUPAC2-(oxolan-2-yl)ethanesulfonyl fluoride
SMILESO=S(=O)(F)CCC1CCCO1
InChIInChI=1S/C6H11FO3S/c7-11(8,9)5-3-6-2-1-4-10-6/h6H,1-5H2
InChIKeyQPAGUZCLGGECBV-UHFFFAOYSA-N
MW182.22 g/mol
LogP0.85
Rot. Bonds3

About 2-(oxolan-2-yl)ethanesulfonyl fluoride

2-(oxolan-2-yl)ethanesulfonyl fluoride (PubChem CID 154575248) has the molecular formula C6H11FO3S and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-(oxolan-2-yl)ethanesulfonyl fluoride.

Molecular Properties

Compound Name2-(oxolan-2-yl)ethanesulfonyl fluoride
PubChem CID154575248
Molecular FormulaC6H11FO3S
Molecular Weight182.22 g/mol
Exact Mass182.04
IUPAC Name2-(oxolan-2-yl)ethanesulfonyl fluoride
SMILESO=S(=O)(F)CCC1CCCO1
InChIInChI=1S/C6H11FO3S/c7-11(8,9)5-3-6-2-1-4-10-6/h6H,1-5H2
InChIKeyQPAGUZCLGGECBV-UHFFFAOYSA-N
XLogP0.85
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.22
LogP ≤ 50.85
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 2-(oxolan-2-yl)ethanesulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Oxolan-2-ylmethanesulfonyl chloride
CID 22636887
2-(Oxolan-2-yl)ethane-1-sulfonamide
CID 65162856
2-(Oxolan-2-yl)ethane-1-sulfonyl chloride
CID 65158435
2,2,2-Trifluoro-1-(oxolan-2-yl)ethane-1-sulfonyl chloride
CID 75480360
7-Oxabicyclo(2.2.1)heptane-2-sulfonyl fluoride
CID 119056968
(5-(Trifluoromethyl)oxolan-2-yl)methanesulfonyl chloride
CID 132327790
4-(Oxiran-2-yl)butane-1-sulfonyl fluoride
CID 58637697
(1S)-2,2,2-trifluoro-1-[(2R)-oxolan-2-yl]ethanesulfonyl chloride
CID 97960545
(1S)-2,2,2-trifluoro-1-[(2S)-oxolan-2-yl]ethanesulfonyl chloride
CID 97960546
(1R)-2,2,2-trifluoro-1-[(2R)-oxolan-2-yl]ethanesulfonyl chloride
CID 97960547
(1R)-2,2,2-trifluoro-1-[(2S)-oxolan-2-yl]ethanesulfonyl chloride
CID 97960548
(1R,2S,4S)-7-Oxabicyclo[2.2.1]heptane-2-sulfonyl fluoride
CID 119057071

Frequently Asked Questions

What is the IUPAC name of 2-(oxolan-2-yl)ethanesulfonyl fluoride?
The IUPAC name of 2-(oxolan-2-yl)ethanesulfonyl fluoride (CID 154575248) is 2-(oxolan-2-yl)ethanesulfonyl fluoride.
What is the SMILES notation for 2-(oxolan-2-yl)ethanesulfonyl fluoride?
The canonical SMILES for 2-(oxolan-2-yl)ethanesulfonyl fluoride is O=S(=O)(F)CCC1CCCO1.
What is the InChIKey of 2-(oxolan-2-yl)ethanesulfonyl fluoride?
The InChIKey is QPAGUZCLGGECBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11FO3S/c7-11(8,9)5-3-6-2-1-4-10-6/h6H,1-5H2.
What are the key properties of 2-(oxolan-2-yl)ethanesulfonyl fluoride?
2-(oxolan-2-yl)ethanesulfonyl fluoride has a molecular weight of 182.22 g/mol, XLogP of 0.85, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxolan-2-yl)ethanesulfonyl fluoride is sourced from PubChem (CID 154575248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).