About 6-fluoro-2-[4-(imidazo[1,2-b]pyridazin-6-yloxymethyl)piperidin-1-yl]-1,3-benzoxazole
6-fluoro-2-[4-(imidazo[1,2-b]pyridazin-6-yloxymethyl)piperidin-1-yl]-1,3-benzoxazole (PubChem CID 154575444) has the molecular formula C19H18FN5O2
and a molecular weight of 367.38 g/mol. Its IUPAC name is 6-fluoro-2-[4-(imidazo[1,2-b]pyridazin-6-yloxymethyl)piperidin-1-yl]-1,3-benzoxazole.
Molecular Properties
| Compound Name | 6-fluoro-2-[4-(imidazo[1,2-b]pyridazin-6-yloxymethyl)piperidin-1-yl]-1,3-benzoxazole |
| PubChem CID | 154575444 |
| Molecular Formula | C19H18FN5O2 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 6-fluoro-2-[4-(imidazo[1,2-b]pyridazin-6-yloxymethyl)piperidin-1-yl]-1,3-benzoxazole |
| SMILES | Fc1ccc2nc(N3CCC(COc4ccc5nccn5n4)CC3)oc2c1 |
| InChI | InChI=1S/C19H18FN5O2/c20-14-1-2-15-16(11-14)27-19(22-15)24-8-5-13(6-9-24)12-26-18-4-3-17-21-7-10-25(17)23-18/h1-4,7,10-11,13H,5-6,8-9,12H2 |
| InChIKey | COJHDCQRSAFQKI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 68.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-fluoro-2-[4-(imidazo[1,2-b]pyridazin-6-yloxymethyl)piperidin-1-yl]-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2-[4-(imidazo[1,2-b]pyridazin-6-yloxymethyl)piperidin-1-yl]-1,3-benzoxazole?
The IUPAC name of 6-fluoro-2-[4-(imidazo[1,2-b]pyridazin-6-yloxymethyl)piperidin-1-yl]-1,3-benzoxazole (CID 154575444) is 6-fluoro-2-[4-(imidazo[1,2-b]pyridazin-6-yloxymethyl)piperidin-1-yl]-1,3-benzoxazole.
What is the SMILES notation for 6-fluoro-2-[4-(imidazo[1,2-b]pyridazin-6-yloxymethyl)piperidin-1-yl]-1,3-benzoxazole?
The canonical SMILES for 6-fluoro-2-[4-(imidazo[1,2-b]pyridazin-6-yloxymethyl)piperidin-1-yl]-1,3-benzoxazole is Fc1ccc2nc(N3CCC(COc4ccc5nccn5n4)CC3)oc2c1.
What is the InChIKey of 6-fluoro-2-[4-(imidazo[1,2-b]pyridazin-6-yloxymethyl)piperidin-1-yl]-1,3-benzoxazole?
The InChIKey is COJHDCQRSAFQKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18FN5O2/c20-14-1-2-15-16(11-14)27-19(22-15)24-8-5-13(6-9-24)12-26-18-4-3-17-21-7-10-25(17)23-18/h1-4,7,10-11,13H,5-6,8-9,12H2.
What are the key properties of 6-fluoro-2-[4-(imidazo[1,2-b]pyridazin-6-yloxymethyl)piperidin-1-yl]-1,3-benzoxazole?
6-fluoro-2-[4-(imidazo[1,2-b]pyridazin-6-yloxymethyl)piperidin-1-yl]-1,3-benzoxazole has a molecular weight of 367.38 g/mol, XLogP of 3.31, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2-[4-(imidazo[1,2-b]pyridazin-6-yloxymethyl)piperidin-1-yl]-1,3-benzoxazole is sourced from PubChem (CID 154575444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).