C22H31F2N3O — CID 154575633
1-[4-[1-[1-(2,4-difluorophenyl)ethyl]piperidin-4-yl]oxybut-2-ynyl]-4-methylpiperazine (PubChem CID 154575633) has the molecular formula C22H31F2N3O and a molecular weight of 391.51 g/mol. Its IUPAC name is 1-[4-[1-[1-(2,4-difluorophenyl)ethyl]piperidin-4-yl]oxybut-2-ynyl]-4-methylpiperazine.
| Compound Name | 1-[4-[1-[1-(2,4-difluorophenyl)ethyl]piperidin-4-yl]oxybut-2-ynyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 154575633 |
| Molecular Formula | C22H31F2N3O |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | 1-[4-[1-[1-(2,4-difluorophenyl)ethyl]piperidin-4-yl]oxybut-2-ynyl]-4-methylpiperazine |
| SMILES | CC(c1ccc(F)cc1F)N1CCC(OCC#CCN2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C22H31F2N3O/c1-18(21-6-5-19(23)17-22(21)24)27-10-7-20(8-11-27)28-16-4-3-9-26-14-12-25(2)13-15-26/h5-6,17-18,20H,7-16H2,1-2H3 |
| InChIKey | JCIGRLYOOATCHY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|