About (3R,4S)-4-(trifluoromethyl)piperidine-3,4-diol;hydrochloride
(3R,4S)-4-(trifluoromethyl)piperidine-3,4-diol;hydrochloride (PubChem CID 154577080) has the molecular formula C6H11ClF3NO2
and a molecular weight of 221.61 g/mol. Its IUPAC name is (3R,4S)-4-(trifluoromethyl)piperidine-3,4-diol;hydrochloride.
Molecular Properties
| Compound Name | (3R,4S)-4-(trifluoromethyl)piperidine-3,4-diol;hydrochloride |
| PubChem CID | 154577080 |
| Molecular Formula | C6H11ClF3NO2 |
| Molecular Weight | 221.61 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | (3R,4S)-4-(trifluoromethyl)piperidine-3,4-diol;hydrochloride |
| SMILES | Cl.O[C@@H]1CNCC[C@@]1(O)C(F)(F)F |
| InChI | InChI=1S/C6H10F3NO2.ClH/c7-6(8,9)5(12)1-2-10-3-4(5)11;/h4,10-12H,1-3H2;1H/t4-,5+;/m1./s1 |
| InChIKey | LIOFHJZLJGZUKS-JBUOLDKXSA-N |
| XLogP | 0.06 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.61 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,4S)-4-(trifluoromethyl)piperidine-3,4-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-4-(trifluoromethyl)piperidine-3,4-diol;hydrochloride?
The IUPAC name of (3R,4S)-4-(trifluoromethyl)piperidine-3,4-diol;hydrochloride (CID 154577080) is (3R,4S)-4-(trifluoromethyl)piperidine-3,4-diol;hydrochloride.
What is the SMILES notation for (3R,4S)-4-(trifluoromethyl)piperidine-3,4-diol;hydrochloride?
The canonical SMILES for (3R,4S)-4-(trifluoromethyl)piperidine-3,4-diol;hydrochloride is Cl.O[C@@H]1CNCC[C@@]1(O)C(F)(F)F.
What is the InChIKey of (3R,4S)-4-(trifluoromethyl)piperidine-3,4-diol;hydrochloride?
The InChIKey is LIOFHJZLJGZUKS-JBUOLDKXSA-N. The full InChI is InChI=1S/C6H10F3NO2.ClH/c7-6(8,9)5(12)1-2-10-3-4(5)11;/h4,10-12H,1-3H2;1H/t4-,5+;/m1./s1.
What are the key properties of (3R,4S)-4-(trifluoromethyl)piperidine-3,4-diol;hydrochloride?
(3R,4S)-4-(trifluoromethyl)piperidine-3,4-diol;hydrochloride has a molecular weight of 221.61 g/mol, XLogP of 0.06, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-4-(trifluoromethyl)piperidine-3,4-diol;hydrochloride is sourced from PubChem (CID 154577080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).