About 5-methylsulfanyl-1,3,4-thiadiazole-2-carbothioamide
5-methylsulfanyl-1,3,4-thiadiazole-2-carbothioamide (PubChem CID 154577344) has the molecular formula C4H5N3S3
and a molecular weight of 191.31 g/mol. Its IUPAC name is 5-methylsulfanyl-1,3,4-thiadiazole-2-carbothioamide.
Molecular Properties
| Compound Name | 5-methylsulfanyl-1,3,4-thiadiazole-2-carbothioamide |
| PubChem CID | 154577344 |
| Molecular Formula | C4H5N3S3 |
| Molecular Weight | 191.31 g/mol |
| Exact Mass | 190.96 |
| IUPAC Name | 5-methylsulfanyl-1,3,4-thiadiazole-2-carbothioamide |
| SMILES | CSc1nnc(C(N)=S)s1 |
| InChI | InChI=1S/C4H5N3S3/c1-9-4-7-6-3(10-4)2(5)8/h1H3,(H2,5,8) |
| InChIKey | VBEXTONMCJLPQL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-methylsulfanyl-1,3,4-thiadiazole-2-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylsulfanyl-1,3,4-thiadiazole-2-carbothioamide?
The IUPAC name of 5-methylsulfanyl-1,3,4-thiadiazole-2-carbothioamide (CID 154577344) is 5-methylsulfanyl-1,3,4-thiadiazole-2-carbothioamide.
What is the SMILES notation for 5-methylsulfanyl-1,3,4-thiadiazole-2-carbothioamide?
The canonical SMILES for 5-methylsulfanyl-1,3,4-thiadiazole-2-carbothioamide is CSc1nnc(C(N)=S)s1.
What is the InChIKey of 5-methylsulfanyl-1,3,4-thiadiazole-2-carbothioamide?
The InChIKey is VBEXTONMCJLPQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3S3/c1-9-4-7-6-3(10-4)2(5)8/h1H3,(H2,5,8).
What are the key properties of 5-methylsulfanyl-1,3,4-thiadiazole-2-carbothioamide?
5-methylsulfanyl-1,3,4-thiadiazole-2-carbothioamide has a molecular weight of 191.31 g/mol, XLogP of 0.89, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylsulfanyl-1,3,4-thiadiazole-2-carbothioamide is sourced from PubChem (CID 154577344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).