C24H32N4O3 — CID 154578542
(1R,3S,4R)-3-(3-cyclopentylpropanoylamino)-N,N-dimethyl-4-(3-phenyl-1,2,4-oxadiazol-5-yl)cyclopentane-1-carboxamide (PubChem CID 154578542) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is (1R,3S,4R)-3-(3-cyclopentylpropanoylamino)-N,N-dimethyl-4-(3-phenyl-1,2,4-oxadiazol-5-yl)cyclopentane-1-carboxamide.
| Compound Name | (1R,3S,4R)-3-(3-cyclopentylpropanoylamino)-N,N-dimethyl-4-(3-phenyl-1,2,4-oxadiazol-5-yl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 154578542 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | (1R,3S,4R)-3-(3-cyclopentylpropanoylamino)-N,N-dimethyl-4-(3-phenyl-1,2,4-oxadiazol-5-yl)cyclopentane-1-carboxamide |
| SMILES | CN(C)C(=O)[C@H]1C[C@H](NC(=O)CCC2CCCC2)[C@H](c2nc(-c3ccccc3)no2)C1 |
| InChI | InChI=1S/C24H32N4O3/c1-28(2)24(30)18-14-19(23-26-22(27-31-23)17-10-4-3-5-11-17)20(15-18)25-21(29)13-12-16-8-6-7-9-16/h3-5,10-11,16,18-20H,6-9,12-15H2,1-2H3,(H,25,29)/t18-,19-,20+/m1/s1 |
| InChIKey | MFJJWLKQEIEBBV-AQNXPRMDSA-N |
| XLogP | 3.77 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |