C18H26N8O3 — CID 154578822
1,1-dimethyl-3-[[1'-(1-methylpyrazole-4-carbonyl)spiro[4,7-dihydrotriazolo[5,1-c][1,4]oxazine-6,3'-piperidine]-3-yl]methyl]urea (PubChem CID 154578822) has the molecular formula C18H26N8O3 and a molecular weight of 402.46 g/mol. Its IUPAC name is 1,1-dimethyl-3-[[1'-(1-methylpyrazole-4-carbonyl)spiro[4,7-dihydrotriazolo[5,1-c][1,4]oxazine-6,3'-piperidine]-3-yl]methyl]urea.
| Compound Name | 1,1-dimethyl-3-[[1'-(1-methylpyrazole-4-carbonyl)spiro[4,7-dihydrotriazolo[5,1-c][1,4]oxazine-6,3'-piperidine]-3-yl]methyl]urea |
|---|---|
| PubChem CID | 154578822 |
| Molecular Formula | C18H26N8O3 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 1,1-dimethyl-3-[[1'-(1-methylpyrazole-4-carbonyl)spiro[4,7-dihydrotriazolo[5,1-c][1,4]oxazine-6,3'-piperidine]-3-yl]methyl]urea |
| SMILES | CN(C)C(=O)NCc1nnn2c1COC1(CCCN(C(=O)c3cnn(C)c3)C1)C2 |
| InChI | InChI=1S/C18H26N8O3/c1-23(2)17(28)19-8-14-15-10-29-18(12-26(15)22-21-14)5-4-6-25(11-18)16(27)13-7-20-24(3)9-13/h7,9H,4-6,8,10-12H2,1-3H3,(H,19,28) |
| InChIKey | PGRDWCQYRJOAHF-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 110.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |