C21H23FN4O2 — CID 154579838
2-benzyl-9-[(3-fluoro-4-pyridinyl)methyl]-3,6,7,8,10,10a-hexahydropyrazino[1,2-a][1,4]diazepine-1,4-dione (PubChem CID 154579838) has the molecular formula C21H23FN4O2 and a molecular weight of 382.44 g/mol. Its IUPAC name is 2-benzyl-9-[(3-fluoro-4-pyridinyl)methyl]-3,6,7,8,10,10a-hexahydropyrazino[1,2-a][1,4]diazepine-1,4-dione.
| Compound Name | 2-benzyl-9-[(3-fluoro-4-pyridinyl)methyl]-3,6,7,8,10,10a-hexahydropyrazino[1,2-a][1,4]diazepine-1,4-dione |
|---|---|
| PubChem CID | 154579838 |
| Molecular Formula | C21H23FN4O2 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 2-benzyl-9-[(3-fluoro-4-pyridinyl)methyl]-3,6,7,8,10,10a-hexahydropyrazino[1,2-a][1,4]diazepine-1,4-dione |
| SMILES | O=C1C2CN(Cc3ccncc3F)CCCN2C(=O)CN1Cc1ccccc1 |
| InChI | InChI=1S/C21H23FN4O2/c22-18-11-23-8-7-17(18)13-24-9-4-10-26-19(14-24)21(28)25(15-20(26)27)12-16-5-2-1-3-6-16/h1-3,5-8,11,19H,4,9-10,12-15H2 |
| InChIKey | DGYHEGYOUNQPLY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |