C23H23F2N3O4 — CID 154579871
9-[2-(4-fluorophenoxy)acetyl]-2-[(4-fluorophenyl)methyl]-3,6,7,8,10,10a-hexahydropyrazino[1,2-a][1,4]diazepine-1,4-dione (PubChem CID 154579871) has the molecular formula C23H23F2N3O4 and a molecular weight of 443.45 g/mol. Its IUPAC name is 9-[2-(4-fluorophenoxy)acetyl]-2-[(4-fluorophenyl)methyl]-3,6,7,8,10,10a-hexahydropyrazino[1,2-a][1,4]diazepine-1,4-dione.
| Compound Name | 9-[2-(4-fluorophenoxy)acetyl]-2-[(4-fluorophenyl)methyl]-3,6,7,8,10,10a-hexahydropyrazino[1,2-a][1,4]diazepine-1,4-dione |
|---|---|
| PubChem CID | 154579871 |
| Molecular Formula | C23H23F2N3O4 |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 9-[2-(4-fluorophenoxy)acetyl]-2-[(4-fluorophenyl)methyl]-3,6,7,8,10,10a-hexahydropyrazino[1,2-a][1,4]diazepine-1,4-dione |
| SMILES | O=C(COc1ccc(F)cc1)N1CCCN2C(=O)CN(Cc3ccc(F)cc3)C(=O)C2C1 |
| InChI | InChI=1S/C23H23F2N3O4/c24-17-4-2-16(3-5-17)12-27-14-21(29)28-11-1-10-26(13-20(28)23(27)31)22(30)15-32-19-8-6-18(25)7-9-19/h2-9,20H,1,10-15H2 |
| InChIKey | CAGUZZQXQKOCBG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |